C20H17F3N2O3 — CID 7960233
[(2R)-1-oxo-1-[4-(trifluoromethyl)anilino]propan-2-yl] 2-(1H-indol-3-yl)acetate (PubChem CID 7960233) has the molecular formula C20H17F3N2O3 and a molecular weight of 390.36 g/mol. Its IUPAC name is [(2R)-1-oxo-1-[4-(trifluoromethyl)anilino]propan-2-yl] 2-(1H-indol-3-yl)acetate.
| Compound Name | [(2R)-1-oxo-1-[4-(trifluoromethyl)anilino]propan-2-yl] 2-(1H-indol-3-yl)acetate |
|---|---|
| PubChem CID | 7960233 |
| Molecular Formula | C20H17F3N2O3 |
| Molecular Weight | 390.36 g/mol |
| Exact Mass | 390.12 |
| IUPAC Name | [(2R)-1-oxo-1-[4-(trifluoromethyl)anilino]propan-2-yl] 2-(1H-indol-3-yl)acetate |
| SMILES | C[C@@H](OC(=O)Cc1c[nH]c2ccccc12)C(=O)Nc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C20H17F3N2O3/c1-12(19(27)25-15-8-6-14(7-9-15)20(21,22)23)28-18(26)10-13-11-24-17-5-3-2-4-16(13)17/h2-9,11-12,24H,10H2,1H3,(H,25,27)/t12-/m1/s1 |
| InChIKey | KPNVZCZISUMCAS-GFCCVEGCSA-N |
| XLogP | 4.30 |
| TPSA | 71.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.36 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |