About [1-[3-(dimethylsulfamoyl)anilino]-1-oxopropan-2-yl] 2-(1H-indol-3-yl)acetate
[1-[3-(dimethylsulfamoyl)anilino]-1-oxopropan-2-yl] 2-(1H-indol-3-yl)acetate (PubChem CID 42900597) has the molecular formula C21H23N3O5S
and a molecular weight of 429.50 g/mol. Its IUPAC name is [1-[3-(dimethylsulfamoyl)anilino]-1-oxopropan-2-yl] 2-(1H-indol-3-yl)acetate.
Molecular Properties
| Compound Name | [1-[3-(dimethylsulfamoyl)anilino]-1-oxopropan-2-yl] 2-(1H-indol-3-yl)acetate |
| PubChem CID | 42900597 |
| Molecular Formula | C21H23N3O5S |
| Molecular Weight | 429.50 g/mol |
| Exact Mass | 429.14 |
| IUPAC Name | [1-[3-(dimethylsulfamoyl)anilino]-1-oxopropan-2-yl] 2-(1H-indol-3-yl)acetate |
| SMILES | CC(OC(=O)Cc1c[nH]c2ccccc12)C(=O)Nc1cccc(S(=O)(=O)N(C)C)c1 |
| InChI | InChI=1S/C21H23N3O5S/c1-14(29-20(25)11-15-13-22-19-10-5-4-9-18(15)19)21(26)23-16-7-6-8-17(12-16)30(27,28)24(2)3/h4-10,12-14,22H,11H2,1-3H3,(H,23,26) |
| InChIKey | ZIQMIXHILBIIAU-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 108.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 429.50 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [1-[3-(dimethylsulfamoyl)anilino]-1-oxopropan-2-yl] 2-(1H-indol-3-yl)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-[3-(dimethylsulfamoyl)anilino]-1-oxopropan-2-yl] 2-(1H-indol-3-yl)acetate?
The IUPAC name of [1-[3-(dimethylsulfamoyl)anilino]-1-oxopropan-2-yl] 2-(1H-indol-3-yl)acetate (CID 42900597) is [1-[3-(dimethylsulfamoyl)anilino]-1-oxopropan-2-yl] 2-(1H-indol-3-yl)acetate.
What is the SMILES notation for [1-[3-(dimethylsulfamoyl)anilino]-1-oxopropan-2-yl] 2-(1H-indol-3-yl)acetate?
The canonical SMILES for [1-[3-(dimethylsulfamoyl)anilino]-1-oxopropan-2-yl] 2-(1H-indol-3-yl)acetate is CC(OC(=O)Cc1c[nH]c2ccccc12)C(=O)Nc1cccc(S(=O)(=O)N(C)C)c1.
What is the InChIKey of [1-[3-(dimethylsulfamoyl)anilino]-1-oxopropan-2-yl] 2-(1H-indol-3-yl)acetate?
The InChIKey is ZIQMIXHILBIIAU-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H23N3O5S/c1-14(29-20(25)11-15-13-22-19-10-5-4-9-18(15)19)21(26)23-16-7-6-8-17(12-16)30(27,28)24(2)3/h4-10,12-14,22H,11H2,1-3H3,(H,23,26).
What are the key properties of [1-[3-(dimethylsulfamoyl)anilino]-1-oxopropan-2-yl] 2-(1H-indol-3-yl)acetate?
[1-[3-(dimethylsulfamoyl)anilino]-1-oxopropan-2-yl] 2-(1H-indol-3-yl)acetate has a molecular weight of 429.50 g/mol, XLogP of 2.53, 7 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [1-[3-(dimethylsulfamoyl)anilino]-1-oxopropan-2-yl] 2-(1H-indol-3-yl)acetate is sourced from PubChem (CID 42900597), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).