C15H11Cl2FN2O4S — CID 55423548
[1-[(3-carbamoylthiophen-2-yl)amino]-1-oxopropan-2-yl] 2,4-dichloro-5-fluorobenzoate (PubChem CID 55423548) has the molecular formula C15H11Cl2FN2O4S and a molecular weight of 405.23 g/mol. Its IUPAC name is [1-[(3-carbamoylthiophen-2-yl)amino]-1-oxopropan-2-yl] 2,4-dichloro-5-fluorobenzoate.
| Compound Name | [1-[(3-carbamoylthiophen-2-yl)amino]-1-oxopropan-2-yl] 2,4-dichloro-5-fluorobenzoate |
|---|---|
| PubChem CID | 55423548 |
| Molecular Formula | C15H11Cl2FN2O4S |
| Molecular Weight | 405.23 g/mol |
| Exact Mass | 403.98 |
| IUPAC Name | [1-[(3-carbamoylthiophen-2-yl)amino]-1-oxopropan-2-yl] 2,4-dichloro-5-fluorobenzoate |
| SMILES | CC(OC(=O)c1cc(F)c(Cl)cc1Cl)C(=O)Nc1sccc1C(N)=O |
| InChI | InChI=1S/C15H11Cl2FN2O4S/c1-6(13(22)20-14-7(12(19)21)2-3-25-14)24-15(23)8-4-11(18)10(17)5-9(8)16/h2-6H,1H3,(H2,19,21)(H,20,22) |
| InChIKey | WOAFDEDIAGSZOG-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 98.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.23 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|