C7H6Cl2NO+ — CID 69226563
2,3-dichlorobenzamide;hydron (PubChem CID 69226563) has the molecular formula C7H6Cl2NO+ and a molecular weight of 191.04 g/mol. Its IUPAC name is 2,3-dichlorobenzamide;hydron.
| Compound Name | 2,3-dichlorobenzamide;hydron |
|---|---|
| PubChem CID | 69226563 |
| Molecular Formula | C7H6Cl2NO+ |
| Molecular Weight | 191.04 g/mol |
| Exact Mass | 189.98 |
| IUPAC Name | 2,3-dichlorobenzamide;hydron |
| SMILES | NC(=O)c1cccc(Cl)c1Cl.[H+] |
| InChI | InChI=1S/C7H5Cl2NO/c8-5-3-1-2-4(6(5)9)7(10)11/h1-3H,(H2,10,11)/p+1 |
| InChIKey | KZKYRHRAVGWEAV-UHFFFAOYSA-O |
| XLogP | 2.20 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.04 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |