(Z)-4-amino-2-(2,3-dichlorophenyl)-4-oxobut-2-enoic acid

C10H7Cl2NO3 — CID 19910847

IUPAC(Z)-4-amino-2-(2,3-dichlorophenyl)-4-oxobut-2-enoic acid
SMILESNC(=O)/C=C(\C(=O)O)c1cccc(Cl)c1Cl
InChIInChI=1S/C10H7Cl2NO3/c11-7-3-1-2-5(9(7)12)6(10(15)16)4-8(13)14/h1-4H,(H2,13,14)(H,15,16)/b6-4-
InChIKeyIPXPQGFEZGQGPZ-XQRVVYSFSA-N
MW260.08 g/mol
LogP1.95
Rot. Bonds3

About (Z)-4-amino-2-(2,3-dichlorophenyl)-4-oxobut-2-enoic acid

(Z)-4-amino-2-(2,3-dichlorophenyl)-4-oxobut-2-enoic acid (PubChem CID 19910847) has the molecular formula C10H7Cl2NO3 and a molecular weight of 260.08 g/mol. Its IUPAC name is (Z)-4-amino-2-(2,3-dichlorophenyl)-4-oxobut-2-enoic acid.

Molecular Properties

Compound Name(Z)-4-amino-2-(2,3-dichlorophenyl)-4-oxobut-2-enoic acid
PubChem CID19910847
Molecular FormulaC10H7Cl2NO3
Molecular Weight260.08 g/mol
Exact Mass258.98
IUPAC Name(Z)-4-amino-2-(2,3-dichlorophenyl)-4-oxobut-2-enoic acid
SMILESNC(=O)/C=C(\C(=O)O)c1cccc(Cl)c1Cl
InChIInChI=1S/C10H7Cl2NO3/c11-7-3-1-2-5(9(7)12)6(10(15)16)4-8(13)14/h1-4H,(H2,13,14)(H,15,16)/b6-4-
InChIKeyIPXPQGFEZGQGPZ-XQRVVYSFSA-N
XLogP1.95
TPSA80.39 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds3
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500260.08
LogP ≤ 51.95
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}

Analyze (Z)-4-amino-2-(2,3-dichlorophenyl)-4-oxobut-2-enoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (Z)-4-amino-2-(2,3-dichlorophenyl)-4-oxobut-2-enoic acid?
The IUPAC name of (Z)-4-amino-2-(2,3-dichlorophenyl)-4-oxobut-2-enoic acid (CID 19910847) is (Z)-4-amino-2-(2,3-dichlorophenyl)-4-oxobut-2-enoic acid.
What is the SMILES notation for (Z)-4-amino-2-(2,3-dichlorophenyl)-4-oxobut-2-enoic acid?
The canonical SMILES for (Z)-4-amino-2-(2,3-dichlorophenyl)-4-oxobut-2-enoic acid is NC(=O)/C=C(\C(=O)O)c1cccc(Cl)c1Cl.
What is the InChIKey of (Z)-4-amino-2-(2,3-dichlorophenyl)-4-oxobut-2-enoic acid?
The InChIKey is IPXPQGFEZGQGPZ-XQRVVYSFSA-N. The full InChI is InChI=1S/C10H7Cl2NO3/c11-7-3-1-2-5(9(7)12)6(10(15)16)4-8(13)14/h1-4H,(H2,13,14)(H,15,16)/b6-4-.
What are the key properties of (Z)-4-amino-2-(2,3-dichlorophenyl)-4-oxobut-2-enoic acid?
(Z)-4-amino-2-(2,3-dichlorophenyl)-4-oxobut-2-enoic acid has a molecular weight of 260.08 g/mol, XLogP of 1.95, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-4-amino-2-(2,3-dichlorophenyl)-4-oxobut-2-enoic acid is sourced from PubChem (CID 19910847), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).