C10H7Cl2NO3 — CID 19910847
(Z)-4-amino-2-(2,3-dichlorophenyl)-4-oxobut-2-enoic acid (PubChem CID 19910847) has the molecular formula C10H7Cl2NO3 and a molecular weight of 260.08 g/mol. Its IUPAC name is (Z)-4-amino-2-(2,3-dichlorophenyl)-4-oxobut-2-enoic acid.
| Compound Name | (Z)-4-amino-2-(2,3-dichlorophenyl)-4-oxobut-2-enoic acid |
|---|---|
| PubChem CID | 19910847 |
| Molecular Formula | C10H7Cl2NO3 |
| Molecular Weight | 260.08 g/mol |
| Exact Mass | 258.98 |
| IUPAC Name | (Z)-4-amino-2-(2,3-dichlorophenyl)-4-oxobut-2-enoic acid |
| SMILES | NC(=O)/C=C(\C(=O)O)c1cccc(Cl)c1Cl |
| InChI | InChI=1S/C10H7Cl2NO3/c11-7-3-1-2-5(9(7)12)6(10(15)16)4-8(13)14/h1-4H,(H2,13,14)(H,15,16)/b6-4- |
| InChIKey | IPXPQGFEZGQGPZ-XQRVVYSFSA-N |
| XLogP | 1.95 |
| TPSA | 80.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.08 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|