C10H8Cl2O2 — CID 69381328
4-(2,3-dichlorophenyl)-4-hydroxybut-3-en-2-one (PubChem CID 69381328) has the molecular formula C10H8Cl2O2 and a molecular weight of 231.08 g/mol. Its IUPAC name is 4-(2,3-dichlorophenyl)-4-hydroxybut-3-en-2-one.
| Compound Name | 4-(2,3-dichlorophenyl)-4-hydroxybut-3-en-2-one |
|---|---|
| PubChem CID | 69381328 |
| Molecular Formula | C10H8Cl2O2 |
| Molecular Weight | 231.08 g/mol |
| Exact Mass | 229.99 |
| IUPAC Name | 4-(2,3-dichlorophenyl)-4-hydroxybut-3-en-2-one |
| SMILES | CC(=O)C=C(O)c1cccc(Cl)c1Cl |
| InChI | InChI=1S/C10H8Cl2O2/c1-6(13)5-9(14)7-3-2-4-8(11)10(7)12/h2-5,14H,1H3 |
| InChIKey | JGTGQBKREJAQHV-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.08 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|