C10H7Cl2NO3 — CID 10563257
(E)-2-amino-4-(2,3-dichlorophenyl)-4-oxobut-2-enoic acid (PubChem CID 10563257) has the molecular formula C10H7Cl2NO3 and a molecular weight of 260.08 g/mol. Its IUPAC name is (E)-2-amino-4-(2,3-dichlorophenyl)-4-oxobut-2-enoic acid.
| Compound Name | (E)-2-amino-4-(2,3-dichlorophenyl)-4-oxobut-2-enoic acid |
|---|---|
| PubChem CID | 10563257 |
| Molecular Formula | C10H7Cl2NO3 |
| Molecular Weight | 260.08 g/mol |
| Exact Mass | 258.98 |
| IUPAC Name | (E)-2-amino-4-(2,3-dichlorophenyl)-4-oxobut-2-enoic acid |
| SMILES | N/C(=C/C(=O)c1cccc(Cl)c1Cl)C(=O)O |
| InChI | InChI=1S/C10H7Cl2NO3/c11-6-3-1-2-5(9(6)12)8(14)4-7(13)10(15)16/h1-4H,13H2,(H,15,16)/b7-4+ |
| InChIKey | IQOZQFQDOWCGJA-QPJJXVBHSA-N |
| XLogP | 2.10 |
| TPSA | 80.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.08 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|