C28H16Cl4O4 — CID 69255292
1,2-bis(2-chlorophenyl)ethane-1,2-dione;1-(2,3-dichlorophenyl)-2-phenylethane-1,2-dione (PubChem CID 69255292) has the molecular formula C28H16Cl4O4 and a molecular weight of 558.24 g/mol. Its IUPAC name is 1,2-bis(2-chlorophenyl)ethane-1,2-dione;1-(2,3-dichlorophenyl)-2-phenylethane-1,2-dione.
| Compound Name | 1,2-bis(2-chlorophenyl)ethane-1,2-dione;1-(2,3-dichlorophenyl)-2-phenylethane-1,2-dione |
|---|---|
| PubChem CID | 69255292 |
| Molecular Formula | C28H16Cl4O4 |
| Molecular Weight | 558.24 g/mol |
| Exact Mass | 555.98 |
| IUPAC Name | 1,2-bis(2-chlorophenyl)ethane-1,2-dione;1-(2,3-dichlorophenyl)-2-phenylethane-1,2-dione |
| SMILES | O=C(C(=O)c1cccc(Cl)c1Cl)c1ccccc1.O=C(C(=O)c1ccccc1Cl)c1ccccc1Cl |
| InChI | InChI=1S/2C14H8Cl2O2/c15-11-7-3-1-5-9(11)13(17)14(18)10-6-2-4-8-12(10)16;15-11-8-4-7-10(12(11)16)14(18)13(17)9-5-2-1-3-6-9/h2*1-8H |
| InChIKey | VYSHEVDGJXDHFQ-UHFFFAOYSA-N |
| XLogP | 8.12 |
| TPSA | 68.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.24 |
| LogP ≤ 5 | 8.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|