C20H14Cl2N2OS — CID 19648807
1-(2-benzoylphenyl)-3-(2,3-dichlorophenyl)thiourea (PubChem CID 19648807) has the molecular formula C20H14Cl2N2OS and a molecular weight of 401.32 g/mol. Its IUPAC name is 1-(2-benzoylphenyl)-3-(2,3-dichlorophenyl)thiourea.
| Compound Name | 1-(2-benzoylphenyl)-3-(2,3-dichlorophenyl)thiourea |
|---|---|
| PubChem CID | 19648807 |
| Molecular Formula | C20H14Cl2N2OS |
| Molecular Weight | 401.32 g/mol |
| Exact Mass | 400.02 |
| IUPAC Name | 1-(2-benzoylphenyl)-3-(2,3-dichlorophenyl)thiourea |
| SMILES | O=C(c1ccccc1)c1ccccc1NC(=S)Nc1cccc(Cl)c1Cl |
| InChI | InChI=1S/C20H14Cl2N2OS/c21-15-10-6-12-17(18(15)22)24-20(26)23-16-11-5-4-9-14(16)19(25)13-7-2-1-3-8-13/h1-12H,(H2,23,24,26) |
| InChIKey | KXOVUHKFLHCQOC-UHFFFAOYSA-N |
| XLogP | 6.03 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.32 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|