C13H9Cl2FN2S — CID 4841872
1-(2,3-dichlorophenyl)-3-(2-fluorophenyl)thiourea (PubChem CID 4841872) has the molecular formula C13H9Cl2FN2S and a molecular weight of 315.20 g/mol. Its IUPAC name is 1-(2,3-dichlorophenyl)-3-(2-fluorophenyl)thiourea.
| Compound Name | 1-(2,3-dichlorophenyl)-3-(2-fluorophenyl)thiourea |
|---|---|
| PubChem CID | 4841872 |
| Molecular Formula | C13H9Cl2FN2S |
| Molecular Weight | 315.20 g/mol |
| Exact Mass | 313.98 |
| IUPAC Name | 1-(2,3-dichlorophenyl)-3-(2-fluorophenyl)thiourea |
| SMILES | Fc1ccccc1NC(=S)Nc1cccc(Cl)c1Cl |
| InChI | InChI=1S/C13H9Cl2FN2S/c14-8-4-3-7-11(12(8)15)18-13(19)17-10-6-2-1-5-9(10)16/h1-7H,(H2,17,18,19) |
| InChIKey | CUVULSVTDHVXPC-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.20 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|