C9H11Cl2N3S — CID 2731362
1-(2,3-dichlorophenyl)-3-(dimethylamino)thiourea (PubChem CID 2731362) has the molecular formula C9H11Cl2N3S and a molecular weight of 264.18 g/mol. Its IUPAC name is 1-(2,3-dichlorophenyl)-3-(dimethylamino)thiourea.
| Compound Name | 1-(2,3-dichlorophenyl)-3-(dimethylamino)thiourea |
|---|---|
| PubChem CID | 2731362 |
| Molecular Formula | C9H11Cl2N3S |
| Molecular Weight | 264.18 g/mol |
| Exact Mass | 263.01 |
| IUPAC Name | 1-(2,3-dichlorophenyl)-3-(dimethylamino)thiourea |
| SMILES | CN(C)NC(=S)Nc1cccc(Cl)c1Cl |
| InChI | InChI=1S/C9H11Cl2N3S/c1-14(2)13-9(15)12-7-5-3-4-6(10)8(7)11/h3-5H,1-2H3,(H2,12,13,15) |
| InChIKey | APLCMEGYWRGYEQ-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 27.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.18 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|