C17H26Cl2N2S — CID 19653296
3-(2,3-dichlorophenyl)-1,1-dipentylthiourea (PubChem CID 19653296) has the molecular formula C17H26Cl2N2S and a molecular weight of 361.38 g/mol. Its IUPAC name is 3-(2,3-dichlorophenyl)-1,1-dipentylthiourea.
| Compound Name | 3-(2,3-dichlorophenyl)-1,1-dipentylthiourea |
|---|---|
| PubChem CID | 19653296 |
| Molecular Formula | C17H26Cl2N2S |
| Molecular Weight | 361.38 g/mol |
| Exact Mass | 360.12 |
| IUPAC Name | 3-(2,3-dichlorophenyl)-1,1-dipentylthiourea |
| SMILES | CCCCCN(CCCCC)C(=S)Nc1cccc(Cl)c1Cl |
| InChI | InChI=1S/C17H26Cl2N2S/c1-3-5-7-12-21(13-8-6-4-2)17(22)20-15-11-9-10-14(18)16(15)19/h9-11H,3-8,12-13H2,1-2H3,(H,20,22) |
| InChIKey | BCAHXTJRSHIKII-UHFFFAOYSA-N |
| XLogP | 6.37 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.38 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|