C15H23ClN2S — CID 3807195
1,1-dibutyl-3-(3-chlorophenyl)thiourea (PubChem CID 3807195) has the molecular formula C15H23ClN2S and a molecular weight of 298.88 g/mol. Its IUPAC name is 1,1-dibutyl-3-(3-chlorophenyl)thiourea.
| Compound Name | 1,1-dibutyl-3-(3-chlorophenyl)thiourea |
|---|---|
| PubChem CID | 3807195 |
| Molecular Formula | C15H23ClN2S |
| Molecular Weight | 298.88 g/mol |
| Exact Mass | 298.13 |
| IUPAC Name | 1,1-dibutyl-3-(3-chlorophenyl)thiourea |
| SMILES | CCCCN(CCCC)C(=S)Nc1cccc(Cl)c1 |
| InChI | InChI=1S/C15H23ClN2S/c1-3-5-10-18(11-6-4-2)15(19)17-14-9-7-8-13(16)12-14/h7-9,12H,3-6,10-11H2,1-2H3,(H,17,19) |
| InChIKey | MLZQNMZLJPWJFK-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.88 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|