C9H11ClN2S — CID 3667583
3-(3-chlorophenyl)-1,1-dimethylthiourea (PubChem CID 3667583) has the molecular formula C9H11ClN2S and a molecular weight of 214.72 g/mol. Its IUPAC name is 3-(3-chlorophenyl)-1,1-dimethylthiourea.
| Compound Name | 3-(3-chlorophenyl)-1,1-dimethylthiourea |
|---|---|
| PubChem CID | 3667583 |
| Molecular Formula | C9H11ClN2S |
| Molecular Weight | 214.72 g/mol |
| Exact Mass | 214.03 |
| IUPAC Name | 3-(3-chlorophenyl)-1,1-dimethylthiourea |
| SMILES | CN(C)C(=S)Nc1cccc(Cl)c1 |
| InChI | InChI=1S/C9H11ClN2S/c1-12(2)9(13)11-8-5-3-4-7(10)6-8/h3-6H,1-2H3,(H,11,13) |
| InChIKey | FDNJCPRUAFJRTH-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.72 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|