C9H12ClIN2S — CID 118931463
3-(4-chlorophenyl)-1,1-dimethylthiourea;hydroiodide (PubChem CID 118931463) has the molecular formula C9H12ClIN2S and a molecular weight of 342.63 g/mol. Its IUPAC name is 3-(4-chlorophenyl)-1,1-dimethylthiourea;hydroiodide.
| Compound Name | 3-(4-chlorophenyl)-1,1-dimethylthiourea;hydroiodide |
|---|---|
| PubChem CID | 118931463 |
| Molecular Formula | C9H12ClIN2S |
| Molecular Weight | 342.63 g/mol |
| Exact Mass | 341.95 |
| IUPAC Name | 3-(4-chlorophenyl)-1,1-dimethylthiourea;hydroiodide |
| SMILES | CN(C)C(=S)Nc1ccc(Cl)cc1.I |
| InChI | InChI=1S/C9H11ClN2S.HI/c1-12(2)9(13)11-8-5-3-7(10)4-6-8;/h3-6H,1-2H3,(H,11,13);1H |
| InChIKey | SSWSYXZJPSOVCL-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.63 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|