C19H17Cl2N5S — CID 166956558
1-[1-[1-(4-chloroanilino)ethenyl]pyrazol-3-yl]-3-(4-chlorophenyl)-1-methylthiourea (PubChem CID 166956558) has the molecular formula C19H17Cl2N5S and a molecular weight of 418.35 g/mol. Its IUPAC name is 1-[1-[1-(4-chloroanilino)ethenyl]pyrazol-3-yl]-3-(4-chlorophenyl)-1-methylthiourea.
| Compound Name | 1-[1-[1-(4-chloroanilino)ethenyl]pyrazol-3-yl]-3-(4-chlorophenyl)-1-methylthiourea |
|---|---|
| PubChem CID | 166956558 |
| Molecular Formula | C19H17Cl2N5S |
| Molecular Weight | 418.35 g/mol |
| Exact Mass | 417.06 |
| IUPAC Name | 1-[1-[1-(4-chloroanilino)ethenyl]pyrazol-3-yl]-3-(4-chlorophenyl)-1-methylthiourea |
| SMILES | C=C(Nc1ccc(Cl)cc1)n1ccc(N(C)C(=S)Nc2ccc(Cl)cc2)n1 |
| InChI | InChI=1S/C19H17Cl2N5S/c1-13(22-16-7-3-14(20)4-8-16)26-12-11-18(24-26)25(2)19(27)23-17-9-5-15(21)6-10-17/h3-12,22H,1H2,2H3,(H,23,27) |
| InChIKey | YHOSKJFSRRAWAG-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 45.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.35 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|