C15H17ClN3S+ — CID 4558258
3-(4-chlorophenyl)-1-ethyl-1-(pyridin-1-ium-4-ylmethyl)thiourea (PubChem CID 4558258) has the molecular formula C15H17ClN3S+ and a molecular weight of 306.84 g/mol. Its IUPAC name is 3-(4-chlorophenyl)-1-ethyl-1-(pyridin-1-ium-4-ylmethyl)thiourea.
| Compound Name | 3-(4-chlorophenyl)-1-ethyl-1-(pyridin-1-ium-4-ylmethyl)thiourea |
|---|---|
| PubChem CID | 4558258 |
| Molecular Formula | C15H17ClN3S+ |
| Molecular Weight | 306.84 g/mol |
| Exact Mass | 306.08 |
| IUPAC Name | 3-(4-chlorophenyl)-1-ethyl-1-(pyridin-1-ium-4-ylmethyl)thiourea |
| SMILES | CCN(Cc1cc[nH+]cc1)C(=S)Nc1ccc(Cl)cc1 |
| InChI | InChI=1S/C15H16ClN3S/c1-2-19(11-12-7-9-17-10-8-12)15(20)18-14-5-3-13(16)4-6-14/h3-10H,2,11H2,1H3,(H,18,20)/p+1 |
| InChIKey | XJTNJSDPZYNPNX-UHFFFAOYSA-O |
| XLogP | 3.37 |
| TPSA | 29.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.84 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|