C23H30ClN4S+ — CID 3608911
3-[(3-chlorophenyl)carbamothioyl-(1H-indol-3-ylmethyl)amino]propyl-diethylazanium (PubChem CID 3608911) has the molecular formula C23H30ClN4S+ and a molecular weight of 430.04 g/mol. Its IUPAC name is 3-[(3-chlorophenyl)carbamothioyl-(1H-indol-3-ylmethyl)amino]propyl-diethylazanium.
| Compound Name | 3-[(3-chlorophenyl)carbamothioyl-(1H-indol-3-ylmethyl)amino]propyl-diethylazanium |
|---|---|
| PubChem CID | 3608911 |
| Molecular Formula | C23H30ClN4S+ |
| Molecular Weight | 430.04 g/mol |
| Exact Mass | 429.19 |
| IUPAC Name | 3-[(3-chlorophenyl)carbamothioyl-(1H-indol-3-ylmethyl)amino]propyl-diethylazanium |
| SMILES | CC[NH+](CC)CCCN(Cc1c[nH]c2ccccc12)C(=S)Nc1cccc(Cl)c1 |
| InChI | InChI=1S/C23H29ClN4S/c1-3-27(4-2)13-8-14-28(23(29)26-20-10-7-9-19(24)15-20)17-18-16-25-22-12-6-5-11-21(18)22/h5-7,9-12,15-16,25H,3-4,8,13-14,17H2,1-2H3,(H,26,29)/p+1 |
| InChIKey | SJXHWGNFSIOXSG-UHFFFAOYSA-O |
| XLogP | 4.34 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.04 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|