C27H39N4S+ — CID 4207895
3-[(2,6-dimethylphenyl)carbamothioyl-[(1-ethylindol-3-yl)methyl]amino]propyl-diethylazanium (PubChem CID 4207895) has the molecular formula C27H39N4S+ and a molecular weight of 451.70 g/mol. Its IUPAC name is 3-[(2,6-dimethylphenyl)carbamothioyl-[(1-ethylindol-3-yl)methyl]amino]propyl-diethylazanium.
| Compound Name | 3-[(2,6-dimethylphenyl)carbamothioyl-[(1-ethylindol-3-yl)methyl]amino]propyl-diethylazanium |
|---|---|
| PubChem CID | 4207895 |
| Molecular Formula | C27H39N4S+ |
| Molecular Weight | 451.70 g/mol |
| Exact Mass | 451.29 |
| IUPAC Name | 3-[(2,6-dimethylphenyl)carbamothioyl-[(1-ethylindol-3-yl)methyl]amino]propyl-diethylazanium |
| SMILES | CCn1cc(CN(CCC[NH+](CC)CC)C(=S)Nc2c(C)cccc2C)c2ccccc21 |
| InChI | InChI=1S/C27H38N4S/c1-6-29(7-2)17-12-18-31(27(32)28-26-21(4)13-11-14-22(26)5)20-23-19-30(8-3)25-16-10-9-15-24(23)25/h9-11,13-16,19H,6-8,12,17-18,20H2,1-5H3,(H,28,32)/p+1 |
| InChIKey | HHXKPBFUCAYNGJ-UHFFFAOYSA-O |
| XLogP | 4.79 |
| TPSA | 24.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.70 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|