C26H34N4OS — CID 53204633
3-(2,3-dimethylphenyl)-1-[(1-methylindol-3-yl)methyl]-1-(3-morpholin-4-ylpropyl)thiourea (PubChem CID 53204633) has the molecular formula C26H34N4OS and a molecular weight of 450.65 g/mol. Its IUPAC name is 3-(2,3-dimethylphenyl)-1-[(1-methylindol-3-yl)methyl]-1-(3-morpholin-4-ylpropyl)thiourea.
| Compound Name | 3-(2,3-dimethylphenyl)-1-[(1-methylindol-3-yl)methyl]-1-(3-morpholin-4-ylpropyl)thiourea |
|---|---|
| PubChem CID | 53204633 |
| Molecular Formula | C26H34N4OS |
| Molecular Weight | 450.65 g/mol |
| Exact Mass | 450.25 |
| IUPAC Name | 3-(2,3-dimethylphenyl)-1-[(1-methylindol-3-yl)methyl]-1-(3-morpholin-4-ylpropyl)thiourea |
| SMILES | Cc1cccc(NC(=S)N(CCCN2CCOCC2)Cc2cn(C)c3ccccc23)c1C |
| InChI | InChI=1S/C26H34N4OS/c1-20-8-6-10-24(21(20)2)27-26(32)30(13-7-12-29-14-16-31-17-15-29)19-22-18-28(3)25-11-5-4-9-23(22)25/h4-6,8-11,18H,7,12-17,19H2,1-3H3,(H,27,32) |
| InChIKey | ZRGYQIDVESJMLT-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 32.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.65 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|