C20H33N3OS — CID 4192966
1-[(2-methylphenyl)methyl]-3-(2-methylpropyl)-1-(3-morpholin-4-ylpropyl)thiourea (PubChem CID 4192966) has the molecular formula C20H33N3OS and a molecular weight of 363.57 g/mol. Its IUPAC name is 1-[(2-methylphenyl)methyl]-3-(2-methylpropyl)-1-(3-morpholin-4-ylpropyl)thiourea.
| Compound Name | 1-[(2-methylphenyl)methyl]-3-(2-methylpropyl)-1-(3-morpholin-4-ylpropyl)thiourea |
|---|---|
| PubChem CID | 4192966 |
| Molecular Formula | C20H33N3OS |
| Molecular Weight | 363.57 g/mol |
| Exact Mass | 363.23 |
| IUPAC Name | 1-[(2-methylphenyl)methyl]-3-(2-methylpropyl)-1-(3-morpholin-4-ylpropyl)thiourea |
| SMILES | Cc1ccccc1CN(CCCN1CCOCC1)C(=S)NCC(C)C |
| InChI | InChI=1S/C20H33N3OS/c1-17(2)15-21-20(25)23(16-19-8-5-4-7-18(19)3)10-6-9-22-11-13-24-14-12-22/h4-5,7-8,17H,6,9-16H2,1-3H3,(H,21,25) |
| InChIKey | DXMHAGVQTHQADQ-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 27.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.57 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|