C24H35N3O2S — CID 3659368
1-[(5-methylfuran-2-yl)methyl]-3-(3-methyl-2-propan-2-ylphenyl)-1-(3-morpholin-4-ylpropyl)thiourea (PubChem CID 3659368) has the molecular formula C24H35N3O2S and a molecular weight of 429.63 g/mol. Its IUPAC name is 1-[(5-methylfuran-2-yl)methyl]-3-(3-methyl-2-propan-2-ylphenyl)-1-(3-morpholin-4-ylpropyl)thiourea.
| Compound Name | 1-[(5-methylfuran-2-yl)methyl]-3-(3-methyl-2-propan-2-ylphenyl)-1-(3-morpholin-4-ylpropyl)thiourea |
|---|---|
| PubChem CID | 3659368 |
| Molecular Formula | C24H35N3O2S |
| Molecular Weight | 429.63 g/mol |
| Exact Mass | 429.24 |
| IUPAC Name | 1-[(5-methylfuran-2-yl)methyl]-3-(3-methyl-2-propan-2-ylphenyl)-1-(3-morpholin-4-ylpropyl)thiourea |
| SMILES | Cc1ccc(CN(CCCN2CCOCC2)C(=S)Nc2cccc(C)c2C(C)C)o1 |
| InChI | InChI=1S/C24H35N3O2S/c1-18(2)23-19(3)7-5-8-22(23)25-24(30)27(17-21-10-9-20(4)29-21)12-6-11-26-13-15-28-16-14-26/h5,7-10,18H,6,11-17H2,1-4H3,(H,25,30) |
| InChIKey | FFPDCKHJUVPBHF-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 40.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.63 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|