C20H27N3O2S — CID 4119516
1-[(5-methylfuran-2-yl)methyl]-3-(4-methylphenyl)-1-(2-morpholin-4-ylethyl)thiourea (PubChem CID 4119516) has the molecular formula C20H27N3O2S and a molecular weight of 373.52 g/mol. Its IUPAC name is 1-[(5-methylfuran-2-yl)methyl]-3-(4-methylphenyl)-1-(2-morpholin-4-ylethyl)thiourea.
| Compound Name | 1-[(5-methylfuran-2-yl)methyl]-3-(4-methylphenyl)-1-(2-morpholin-4-ylethyl)thiourea |
|---|---|
| PubChem CID | 4119516 |
| Molecular Formula | C20H27N3O2S |
| Molecular Weight | 373.52 g/mol |
| Exact Mass | 373.18 |
| IUPAC Name | 1-[(5-methylfuran-2-yl)methyl]-3-(4-methylphenyl)-1-(2-morpholin-4-ylethyl)thiourea |
| SMILES | Cc1ccc(NC(=S)N(CCN2CCOCC2)Cc2ccc(C)o2)cc1 |
| InChI | InChI=1S/C20H27N3O2S/c1-16-3-6-18(7-4-16)21-20(26)23(15-19-8-5-17(2)25-19)10-9-22-11-13-24-14-12-22/h3-8H,9-15H2,1-2H3,(H,21,26) |
| InChIKey | BKPMJQYJERFOLI-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 40.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.52 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|