C26H37N3OS — CID 4625166
1-[(2-methylphenyl)methyl]-3-(3-methyl-2-propan-2-ylphenyl)-1-(3-morpholin-4-ylpropyl)thiourea (PubChem CID 4625166) has the molecular formula C26H37N3OS and a molecular weight of 439.67 g/mol. Its IUPAC name is 1-[(2-methylphenyl)methyl]-3-(3-methyl-2-propan-2-ylphenyl)-1-(3-morpholin-4-ylpropyl)thiourea.
| Compound Name | 1-[(2-methylphenyl)methyl]-3-(3-methyl-2-propan-2-ylphenyl)-1-(3-morpholin-4-ylpropyl)thiourea |
|---|---|
| PubChem CID | 4625166 |
| Molecular Formula | C26H37N3OS |
| Molecular Weight | 439.67 g/mol |
| Exact Mass | 439.27 |
| IUPAC Name | 1-[(2-methylphenyl)methyl]-3-(3-methyl-2-propan-2-ylphenyl)-1-(3-morpholin-4-ylpropyl)thiourea |
| SMILES | Cc1ccccc1CN(CCCN1CCOCC1)C(=S)Nc1cccc(C)c1C(C)C |
| InChI | InChI=1S/C26H37N3OS/c1-20(2)25-22(4)10-7-12-24(25)27-26(31)29(19-23-11-6-5-9-21(23)3)14-8-13-28-15-17-30-18-16-28/h5-7,9-12,20H,8,13-19H2,1-4H3,(H,27,31) |
| InChIKey | WWZMYWIYMDDSJE-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 27.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.67 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|