C19H31N3O2S — CID 4622864
1-[(2-methoxyphenyl)methyl]-3-(2-methylpropyl)-1-(2-morpholin-4-ylethyl)thiourea (PubChem CID 4622864) has the molecular formula C19H31N3O2S and a molecular weight of 365.54 g/mol. Its IUPAC name is 1-[(2-methoxyphenyl)methyl]-3-(2-methylpropyl)-1-(2-morpholin-4-ylethyl)thiourea.
| Compound Name | 1-[(2-methoxyphenyl)methyl]-3-(2-methylpropyl)-1-(2-morpholin-4-ylethyl)thiourea |
|---|---|
| PubChem CID | 4622864 |
| Molecular Formula | C19H31N3O2S |
| Molecular Weight | 365.54 g/mol |
| Exact Mass | 365.21 |
| IUPAC Name | 1-[(2-methoxyphenyl)methyl]-3-(2-methylpropyl)-1-(2-morpholin-4-ylethyl)thiourea |
| SMILES | COc1ccccc1CN(CCN1CCOCC1)C(=S)NCC(C)C |
| InChI | InChI=1S/C19H31N3O2S/c1-16(2)14-20-19(25)22(9-8-21-10-12-24-13-11-21)15-17-6-4-5-7-18(17)23-3/h4-7,16H,8-15H2,1-3H3,(H,20,25) |
| InChIKey | MAHHHOCPBLXHQE-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 36.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.54 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|