C21H25ClFN3O2S — CID 4099431
3-(4-chloro-3-methoxyphenyl)-1-[(2-fluorophenyl)methyl]-1-(2-morpholin-4-ylethyl)thiourea (PubChem CID 4099431) has the molecular formula C21H25ClFN3O2S and a molecular weight of 437.97 g/mol. Its IUPAC name is 3-(4-chloro-3-methoxyphenyl)-1-[(2-fluorophenyl)methyl]-1-(2-morpholin-4-ylethyl)thiourea.
| Compound Name | 3-(4-chloro-3-methoxyphenyl)-1-[(2-fluorophenyl)methyl]-1-(2-morpholin-4-ylethyl)thiourea |
|---|---|
| PubChem CID | 4099431 |
| Molecular Formula | C21H25ClFN3O2S |
| Molecular Weight | 437.97 g/mol |
| Exact Mass | 437.13 |
| IUPAC Name | 3-(4-chloro-3-methoxyphenyl)-1-[(2-fluorophenyl)methyl]-1-(2-morpholin-4-ylethyl)thiourea |
| SMILES | COc1cc(NC(=S)N(CCN2CCOCC2)Cc2ccccc2F)ccc1Cl |
| InChI | InChI=1S/C21H25ClFN3O2S/c1-27-20-14-17(6-7-18(20)22)24-21(29)26(9-8-25-10-12-28-13-11-25)15-16-4-2-3-5-19(16)23/h2-7,14H,8-13,15H2,1H3,(H,24,29) |
| InChIKey | GHJCFNNVEIXTOM-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 36.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.97 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|