C22H34FN3OS — CID 17065692
3-cyclooctyl-1-[(2-fluorophenyl)methyl]-1-(2-morpholin-4-ylethyl)thiourea (PubChem CID 17065692) has the molecular formula C22H34FN3OS and a molecular weight of 407.60 g/mol. Its IUPAC name is 3-cyclooctyl-1-[(2-fluorophenyl)methyl]-1-(2-morpholin-4-ylethyl)thiourea.
| Compound Name | 3-cyclooctyl-1-[(2-fluorophenyl)methyl]-1-(2-morpholin-4-ylethyl)thiourea |
|---|---|
| PubChem CID | 17065692 |
| Molecular Formula | C22H34FN3OS |
| Molecular Weight | 407.60 g/mol |
| Exact Mass | 407.24 |
| IUPAC Name | 3-cyclooctyl-1-[(2-fluorophenyl)methyl]-1-(2-morpholin-4-ylethyl)thiourea |
| SMILES | Fc1ccccc1CN(CCN1CCOCC1)C(=S)NC1CCCCCCC1 |
| InChI | InChI=1S/C22H34FN3OS/c23-21-11-7-6-8-19(21)18-26(13-12-25-14-16-27-17-15-25)22(28)24-20-9-4-2-1-3-5-10-20/h6-8,11,20H,1-5,9-10,12-18H2,(H,24,28) |
| InChIKey | ODHKQBBRNYUCCB-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 27.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.60 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|