C20H32N4OS — CID 4188209
3-cycloheptyl-1-(2-morpholin-4-ylethyl)-1-(pyridin-4-ylmethyl)thiourea (PubChem CID 4188209) has the molecular formula C20H32N4OS and a molecular weight of 376.57 g/mol. Its IUPAC name is 3-cycloheptyl-1-(2-morpholin-4-ylethyl)-1-(pyridin-4-ylmethyl)thiourea.
| Compound Name | 3-cycloheptyl-1-(2-morpholin-4-ylethyl)-1-(pyridin-4-ylmethyl)thiourea |
|---|---|
| PubChem CID | 4188209 |
| Molecular Formula | C20H32N4OS |
| Molecular Weight | 376.57 g/mol |
| Exact Mass | 376.23 |
| IUPAC Name | 3-cycloheptyl-1-(2-morpholin-4-ylethyl)-1-(pyridin-4-ylmethyl)thiourea |
| SMILES | S=C(NC1CCCCCC1)N(CCN1CCOCC1)Cc1ccncc1 |
| InChI | InChI=1S/C20H32N4OS/c26-20(22-19-5-3-1-2-4-6-19)24(17-18-7-9-21-10-8-18)12-11-23-13-15-25-16-14-23/h7-10,19H,1-6,11-17H2,(H,22,26) |
| InChIKey | HCZJPHRFCNBISR-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 40.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.57 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|