C24H39ClN4OS — CID 17065822
1-[(4-chlorophenyl)methyl]-1-(3-morpholin-4-ylpropyl)-3-(2,2,6,6-tetramethylpiperidin-4-yl)thiourea (PubChem CID 17065822) has the molecular formula C24H39ClN4OS and a molecular weight of 467.12 g/mol. Its IUPAC name is 1-[(4-chlorophenyl)methyl]-1-(3-morpholin-4-ylpropyl)-3-(2,2,6,6-tetramethylpiperidin-4-yl)thiourea.
| Compound Name | 1-[(4-chlorophenyl)methyl]-1-(3-morpholin-4-ylpropyl)-3-(2,2,6,6-tetramethylpiperidin-4-yl)thiourea |
|---|---|
| PubChem CID | 17065822 |
| Molecular Formula | C24H39ClN4OS |
| Molecular Weight | 467.12 g/mol |
| Exact Mass | 466.25 |
| IUPAC Name | 1-[(4-chlorophenyl)methyl]-1-(3-morpholin-4-ylpropyl)-3-(2,2,6,6-tetramethylpiperidin-4-yl)thiourea |
| SMILES | CC1(C)CC(NC(=S)N(CCCN2CCOCC2)Cc2ccc(Cl)cc2)CC(C)(C)N1 |
| InChI | InChI=1S/C24H39ClN4OS/c1-23(2)16-21(17-24(3,4)27-23)26-22(31)29(18-19-6-8-20(25)9-7-19)11-5-10-28-12-14-30-15-13-28/h6-9,21,27H,5,10-18H2,1-4H3,(H,26,31) |
| InChIKey | ZPAJBGWFPKXXDK-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 39.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.12 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|