C26H47N5S — CID 17065996
1-[[4-(diethylamino)phenyl]methyl]-1-[3-(dimethylamino)propyl]-3-(2,2,6,6-tetramethylpiperidin-4-yl)thiourea (PubChem CID 17065996) has the molecular formula C26H47N5S and a molecular weight of 461.76 g/mol. Its IUPAC name is 1-[[4-(diethylamino)phenyl]methyl]-1-[3-(dimethylamino)propyl]-3-(2,2,6,6-tetramethylpiperidin-4-yl)thiourea.
| Compound Name | 1-[[4-(diethylamino)phenyl]methyl]-1-[3-(dimethylamino)propyl]-3-(2,2,6,6-tetramethylpiperidin-4-yl)thiourea |
|---|---|
| PubChem CID | 17065996 |
| Molecular Formula | C26H47N5S |
| Molecular Weight | 461.76 g/mol |
| Exact Mass | 461.36 |
| IUPAC Name | 1-[[4-(diethylamino)phenyl]methyl]-1-[3-(dimethylamino)propyl]-3-(2,2,6,6-tetramethylpiperidin-4-yl)thiourea |
| SMILES | CCN(CC)c1ccc(CN(CCCN(C)C)C(=S)NC2CC(C)(C)NC(C)(C)C2)cc1 |
| InChI | InChI=1S/C26H47N5S/c1-9-30(10-2)23-14-12-21(13-15-23)20-31(17-11-16-29(7)8)24(32)27-22-18-25(3,4)28-26(5,6)19-22/h12-15,22,28H,9-11,16-20H2,1-8H3,(H,27,32) |
| InChIKey | LYJUISYVFVOGJP-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 33.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.76 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|