C23H39N5S — CID 17066038
1-[(1-ethylpyrrolidin-2-yl)methyl]-1-(pyridin-4-ylmethyl)-3-(2,2,6,6-tetramethylpiperidin-4-yl)thiourea (PubChem CID 17066038) has the molecular formula C23H39N5S and a molecular weight of 417.67 g/mol. Its IUPAC name is 1-[(1-ethylpyrrolidin-2-yl)methyl]-1-(pyridin-4-ylmethyl)-3-(2,2,6,6-tetramethylpiperidin-4-yl)thiourea.
| Compound Name | 1-[(1-ethylpyrrolidin-2-yl)methyl]-1-(pyridin-4-ylmethyl)-3-(2,2,6,6-tetramethylpiperidin-4-yl)thiourea |
|---|---|
| PubChem CID | 17066038 |
| Molecular Formula | C23H39N5S |
| Molecular Weight | 417.67 g/mol |
| Exact Mass | 417.29 |
| IUPAC Name | 1-[(1-ethylpyrrolidin-2-yl)methyl]-1-(pyridin-4-ylmethyl)-3-(2,2,6,6-tetramethylpiperidin-4-yl)thiourea |
| SMILES | CCN1CCCC1CN(Cc1ccncc1)C(=S)NC1CC(C)(C)NC(C)(C)C1 |
| InChI | InChI=1S/C23H39N5S/c1-6-27-13-7-8-20(27)17-28(16-18-9-11-24-12-10-18)21(29)25-19-14-22(2,3)26-23(4,5)15-19/h9-12,19-20,26H,6-8,13-17H2,1-5H3,(H,25,29) |
| InChIKey | BZYUSTOXKAFNND-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 43.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.67 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|