C23H37FN4OS — CID 17066016
1-[(2-fluorophenyl)methyl]-1-(2-morpholin-4-ylethyl)-3-(2,2,6,6-tetramethylpiperidin-4-yl)thiourea (PubChem CID 17066016) has the molecular formula C23H37FN4OS and a molecular weight of 436.64 g/mol. Its IUPAC name is 1-[(2-fluorophenyl)methyl]-1-(2-morpholin-4-ylethyl)-3-(2,2,6,6-tetramethylpiperidin-4-yl)thiourea.
| Compound Name | 1-[(2-fluorophenyl)methyl]-1-(2-morpholin-4-ylethyl)-3-(2,2,6,6-tetramethylpiperidin-4-yl)thiourea |
|---|---|
| PubChem CID | 17066016 |
| Molecular Formula | C23H37FN4OS |
| Molecular Weight | 436.64 g/mol |
| Exact Mass | 436.27 |
| IUPAC Name | 1-[(2-fluorophenyl)methyl]-1-(2-morpholin-4-ylethyl)-3-(2,2,6,6-tetramethylpiperidin-4-yl)thiourea |
| SMILES | CC1(C)CC(NC(=S)N(CCN2CCOCC2)Cc2ccccc2F)CC(C)(C)N1 |
| InChI | InChI=1S/C23H37FN4OS/c1-22(2)15-19(16-23(3,4)26-22)25-21(30)28(10-9-27-11-13-29-14-12-27)17-18-7-5-6-8-20(18)24/h5-8,19,26H,9-17H2,1-4H3,(H,25,30) |
| InChIKey | DWOAPYBSPUMHBW-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 39.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.64 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|