C24H39N3O3S — CID 17065621
3-cyclooctyl-1-[(3,4-dimethoxyphenyl)methyl]-1-(2-morpholin-4-ylethyl)thiourea (PubChem CID 17065621) has the molecular formula C24H39N3O3S and a molecular weight of 449.66 g/mol. Its IUPAC name is 3-cyclooctyl-1-[(3,4-dimethoxyphenyl)methyl]-1-(2-morpholin-4-ylethyl)thiourea.
| Compound Name | 3-cyclooctyl-1-[(3,4-dimethoxyphenyl)methyl]-1-(2-morpholin-4-ylethyl)thiourea |
|---|---|
| PubChem CID | 17065621 |
| Molecular Formula | C24H39N3O3S |
| Molecular Weight | 449.66 g/mol |
| Exact Mass | 449.27 |
| IUPAC Name | 3-cyclooctyl-1-[(3,4-dimethoxyphenyl)methyl]-1-(2-morpholin-4-ylethyl)thiourea |
| SMILES | COc1ccc(CN(CCN2CCOCC2)C(=S)NC2CCCCCCC2)cc1OC |
| InChI | InChI=1S/C24H39N3O3S/c1-28-22-11-10-20(18-23(22)29-2)19-27(13-12-26-14-16-30-17-15-26)24(31)25-21-8-6-4-3-5-7-9-21/h10-11,18,21H,3-9,12-17,19H2,1-2H3,(H,25,31) |
| InChIKey | LEJYXCOWKQBZBM-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 46.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.66 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|