C22H37N3O2S — CID 17065643
3-cyclooctyl-1-[(3,4-dimethoxyphenyl)methyl]-1-[2-(dimethylamino)ethyl]thiourea (PubChem CID 17065643) has the molecular formula C22H37N3O2S and a molecular weight of 407.62 g/mol. Its IUPAC name is 3-cyclooctyl-1-[(3,4-dimethoxyphenyl)methyl]-1-[2-(dimethylamino)ethyl]thiourea.
| Compound Name | 3-cyclooctyl-1-[(3,4-dimethoxyphenyl)methyl]-1-[2-(dimethylamino)ethyl]thiourea |
|---|---|
| PubChem CID | 17065643 |
| Molecular Formula | C22H37N3O2S |
| Molecular Weight | 407.62 g/mol |
| Exact Mass | 407.26 |
| IUPAC Name | 3-cyclooctyl-1-[(3,4-dimethoxyphenyl)methyl]-1-[2-(dimethylamino)ethyl]thiourea |
| SMILES | COc1ccc(CN(CCN(C)C)C(=S)NC2CCCCCCC2)cc1OC |
| InChI | InChI=1S/C22H37N3O2S/c1-24(2)14-15-25(17-18-12-13-20(26-3)21(16-18)27-4)22(28)23-19-10-8-6-5-7-9-11-19/h12-13,16,19H,5-11,14-15,17H2,1-4H3,(H,23,28) |
| InChIKey | CJGSEBUAQPDNRS-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 36.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.62 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|