C26H37N3O2S — CID 17065882
1-[(3-methoxyphenyl)methyl]-1-[(4-methoxyphenyl)methyl]-3-(2,2,6,6-tetramethylpiperidin-4-yl)thiourea (PubChem CID 17065882) has the molecular formula C26H37N3O2S and a molecular weight of 455.67 g/mol. Its IUPAC name is 1-[(3-methoxyphenyl)methyl]-1-[(4-methoxyphenyl)methyl]-3-(2,2,6,6-tetramethylpiperidin-4-yl)thiourea.
| Compound Name | 1-[(3-methoxyphenyl)methyl]-1-[(4-methoxyphenyl)methyl]-3-(2,2,6,6-tetramethylpiperidin-4-yl)thiourea |
|---|---|
| PubChem CID | 17065882 |
| Molecular Formula | C26H37N3O2S |
| Molecular Weight | 455.67 g/mol |
| Exact Mass | 455.26 |
| IUPAC Name | 1-[(3-methoxyphenyl)methyl]-1-[(4-methoxyphenyl)methyl]-3-(2,2,6,6-tetramethylpiperidin-4-yl)thiourea |
| SMILES | COc1ccc(CN(Cc2cccc(OC)c2)C(=S)NC2CC(C)(C)NC(C)(C)C2)cc1 |
| InChI | InChI=1S/C26H37N3O2S/c1-25(2)15-21(16-26(3,4)28-25)27-24(32)29(17-19-10-12-22(30-5)13-11-19)18-20-8-7-9-23(14-20)31-6/h7-14,21,28H,15-18H2,1-6H3,(H,27,32) |
| InChIKey | UDNJLQWCYLYZOH-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 45.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.67 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|