C22H34N2O2S — CID 17065543
3-cyclooctyl-1-[(3-methoxyphenyl)methyl]-1-(oxolan-2-ylmethyl)thiourea (PubChem CID 17065543) has the molecular formula C22H34N2O2S and a molecular weight of 390.59 g/mol. Its IUPAC name is 3-cyclooctyl-1-[(3-methoxyphenyl)methyl]-1-(oxolan-2-ylmethyl)thiourea.
| Compound Name | 3-cyclooctyl-1-[(3-methoxyphenyl)methyl]-1-(oxolan-2-ylmethyl)thiourea |
|---|---|
| PubChem CID | 17065543 |
| Molecular Formula | C22H34N2O2S |
| Molecular Weight | 390.59 g/mol |
| Exact Mass | 390.23 |
| IUPAC Name | 3-cyclooctyl-1-[(3-methoxyphenyl)methyl]-1-(oxolan-2-ylmethyl)thiourea |
| SMILES | COc1cccc(CN(CC2CCCO2)C(=S)NC2CCCCCCC2)c1 |
| InChI | InChI=1S/C22H34N2O2S/c1-25-20-12-7-9-18(15-20)16-24(17-21-13-8-14-26-21)22(27)23-19-10-5-3-2-4-6-11-19/h7,9,12,15,19,21H,2-6,8,10-11,13-14,16-17H2,1H3,(H,23,27) |
| InChIKey | BFDZEASGHTXNHX-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.59 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|