C20H24N2O3 — CID 75387976
N-[(3-methoxyphenyl)methyl]-5-methyl-N-(oxolan-2-ylmethyl)pyridine-2-carboxamide (PubChem CID 75387976) has the molecular formula C20H24N2O3 and a molecular weight of 340.42 g/mol. Its IUPAC name is N-[(3-methoxyphenyl)methyl]-5-methyl-N-(oxolan-2-ylmethyl)pyridine-2-carboxamide.
| Compound Name | N-[(3-methoxyphenyl)methyl]-5-methyl-N-(oxolan-2-ylmethyl)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 75387976 |
| Molecular Formula | C20H24N2O3 |
| Molecular Weight | 340.42 g/mol |
| Exact Mass | 340.18 |
| IUPAC Name | N-[(3-methoxyphenyl)methyl]-5-methyl-N-(oxolan-2-ylmethyl)pyridine-2-carboxamide |
| SMILES | COc1cccc(CN(CC2CCCO2)C(=O)c2ccc(C)cn2)c1 |
| InChI | InChI=1S/C20H24N2O3/c1-15-8-9-19(21-12-15)20(23)22(14-18-7-4-10-25-18)13-16-5-3-6-17(11-16)24-2/h3,5-6,8-9,11-12,18H,4,7,10,13-14H2,1-2H3 |
| InChIKey | LYDFUVUZGZCTFL-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 51.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.42 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |