C20H24N2O4 — CID 51121582
3,5-dimethoxy-N-(oxolan-2-ylmethyl)-N-(pyridin-3-ylmethyl)benzamide (PubChem CID 51121582) has the molecular formula C20H24N2O4 and a molecular weight of 356.42 g/mol. Its IUPAC name is 3,5-dimethoxy-N-(oxolan-2-ylmethyl)-N-(pyridin-3-ylmethyl)benzamide.
| Compound Name | 3,5-dimethoxy-N-(oxolan-2-ylmethyl)-N-(pyridin-3-ylmethyl)benzamide |
|---|---|
| PubChem CID | 51121582 |
| Molecular Formula | C20H24N2O4 |
| Molecular Weight | 356.42 g/mol |
| Exact Mass | 356.17 |
| IUPAC Name | 3,5-dimethoxy-N-(oxolan-2-ylmethyl)-N-(pyridin-3-ylmethyl)benzamide |
| SMILES | COc1cc(OC)cc(C(=O)N(Cc2cccnc2)CC2CCCO2)c1 |
| InChI | InChI=1S/C20H24N2O4/c1-24-18-9-16(10-19(11-18)25-2)20(23)22(14-17-6-4-8-26-17)13-15-5-3-7-21-12-15/h3,5,7,9-12,17H,4,6,8,13-14H2,1-2H3 |
| InChIKey | IFGYPKBVRFPNMN-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 60.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.42 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |