C21H20N2O4 — CID 71890174
2-oxo-N-(oxolan-2-ylmethyl)-N-(pyridin-3-ylmethyl)chromene-3-carboxamide (PubChem CID 71890174) has the molecular formula C21H20N2O4 and a molecular weight of 364.40 g/mol. Its IUPAC name is 2-oxo-N-(oxolan-2-ylmethyl)-N-(pyridin-3-ylmethyl)chromene-3-carboxamide.
| Compound Name | 2-oxo-N-(oxolan-2-ylmethyl)-N-(pyridin-3-ylmethyl)chromene-3-carboxamide |
|---|---|
| PubChem CID | 71890174 |
| Molecular Formula | C21H20N2O4 |
| Molecular Weight | 364.40 g/mol |
| Exact Mass | 364.14 |
| IUPAC Name | 2-oxo-N-(oxolan-2-ylmethyl)-N-(pyridin-3-ylmethyl)chromene-3-carboxamide |
| SMILES | O=C(c1cc2ccccc2oc1=O)N(Cc1cccnc1)CC1CCCO1 |
| InChI | InChI=1S/C21H20N2O4/c24-20(18-11-16-6-1-2-8-19(16)27-21(18)25)23(14-17-7-4-10-26-17)13-15-5-3-9-22-12-15/h1-3,5-6,8-9,11-12,17H,4,7,10,13-14H2 |
| InChIKey | MZSKTUMYNBYKPQ-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 72.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.40 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|