C19H29N3O3 — CID 2215150
N-[(4-methoxyphenyl)methyl]-N'-(2,2,6,6-tetramethylpiperidin-4-yl)oxamide (PubChem CID 2215150) has the molecular formula C19H29N3O3 and a molecular weight of 347.46 g/mol. Its IUPAC name is N-[(4-methoxyphenyl)methyl]-N'-(2,2,6,6-tetramethylpiperidin-4-yl)oxamide.
| Compound Name | N-[(4-methoxyphenyl)methyl]-N'-(2,2,6,6-tetramethylpiperidin-4-yl)oxamide |
|---|---|
| PubChem CID | 2215150 |
| Molecular Formula | C19H29N3O3 |
| Molecular Weight | 347.46 g/mol |
| Exact Mass | 347.22 |
| IUPAC Name | N-[(4-methoxyphenyl)methyl]-N'-(2,2,6,6-tetramethylpiperidin-4-yl)oxamide |
| SMILES | COc1ccc(CNC(=O)C(=O)NC2CC(C)(C)NC(C)(C)C2)cc1 |
| InChI | InChI=1S/C19H29N3O3/c1-18(2)10-14(11-19(3,4)22-18)21-17(24)16(23)20-12-13-6-8-15(25-5)9-7-13/h6-9,14,22H,10-12H2,1-5H3,(H,20,23)(H,21,24) |
| InChIKey | RREDMSHXQBYTKM-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.46 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|