C12H13Cl2NO2 — CID 7959638
(1R)-2,2-dichloro-N-[(4-methoxyphenyl)methyl]cyclopropane-1-carboxamide (PubChem CID 7959638) has the molecular formula C12H13Cl2NO2 and a molecular weight of 274.15 g/mol. Its IUPAC name is (1R)-2,2-dichloro-N-[(4-methoxyphenyl)methyl]cyclopropane-1-carboxamide.
| Compound Name | (1R)-2,2-dichloro-N-[(4-methoxyphenyl)methyl]cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 7959638 |
| Molecular Formula | C12H13Cl2NO2 |
| Molecular Weight | 274.15 g/mol |
| Exact Mass | 273.03 |
| IUPAC Name | (1R)-2,2-dichloro-N-[(4-methoxyphenyl)methyl]cyclopropane-1-carboxamide |
| SMILES | COc1ccc(CNC(=O)[C@H]2CC2(Cl)Cl)cc1 |
| InChI | InChI=1S/C12H13Cl2NO2/c1-17-9-4-2-8(3-5-9)7-15-11(16)10-6-12(10,13)14/h2-5,10H,6-7H2,1H3,(H,15,16)/t10-/m1/s1 |
| InChIKey | QKHXODPHGQJFME-SNVBAGLBSA-N |
| XLogP | 2.51 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.15 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|