C15H22Cl3NO — CID 143534817
2,2-dichloro-N-[(4-chlorophenyl)methyl]cyclopropane-1-carboxamide;ethane (PubChem CID 143534817) has the molecular formula C15H22Cl3NO and a molecular weight of 338.71 g/mol. Its IUPAC name is 2,2-dichloro-N-[(4-chlorophenyl)methyl]cyclopropane-1-carboxamide;ethane.
| Compound Name | 2,2-dichloro-N-[(4-chlorophenyl)methyl]cyclopropane-1-carboxamide;ethane |
|---|---|
| PubChem CID | 143534817 |
| Molecular Formula | C15H22Cl3NO |
| Molecular Weight | 338.71 g/mol |
| Exact Mass | 337.08 |
| IUPAC Name | 2,2-dichloro-N-[(4-chlorophenyl)methyl]cyclopropane-1-carboxamide;ethane |
| SMILES | CC.CC.O=C(NCc1ccc(Cl)cc1)C1CC1(Cl)Cl |
| InChI | InChI=1S/C11H10Cl3NO.2C2H6/c12-8-3-1-7(2-4-8)6-15-10(16)9-5-11(9,13)14;2*1-2/h1-4,9H,5-6H2,(H,15,16);2*1-2H3 |
| InChIKey | MCBJVJVXVJPBMV-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.71 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|