C16H21ClN2O — CID 170378931
1-[(4-chlorophenyl)methyl]-3-(6-methylspiro[3.3]heptan-2-yl)urea (PubChem CID 170378931) has the molecular formula C16H21ClN2O and a molecular weight of 292.81 g/mol. Its IUPAC name is 1-[(4-chlorophenyl)methyl]-3-(6-methylspiro[3.3]heptan-2-yl)urea.
| Compound Name | 1-[(4-chlorophenyl)methyl]-3-(6-methylspiro[3.3]heptan-2-yl)urea |
|---|---|
| PubChem CID | 170378931 |
| Molecular Formula | C16H21ClN2O |
| Molecular Weight | 292.81 g/mol |
| Exact Mass | 292.13 |
| IUPAC Name | 1-[(4-chlorophenyl)methyl]-3-(6-methylspiro[3.3]heptan-2-yl)urea |
| SMILES | CC1CC2(C1)CC(NC(=O)NCc1ccc(Cl)cc1)C2 |
| InChI | InChI=1S/C16H21ClN2O/c1-11-6-16(7-11)8-14(9-16)19-15(20)18-10-12-2-4-13(17)5-3-12/h2-5,11,14H,6-10H2,1H3,(H2,18,19,20) |
| InChIKey | NHESWMCBTAZCJG-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.81 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |