C22H36N4OS — CID 17065733
3-cyclooctyl-1-(3-morpholin-4-ylpropyl)-1-(pyridin-2-ylmethyl)thiourea (PubChem CID 17065733) has the molecular formula C22H36N4OS and a molecular weight of 404.62 g/mol. Its IUPAC name is 3-cyclooctyl-1-(3-morpholin-4-ylpropyl)-1-(pyridin-2-ylmethyl)thiourea.
| Compound Name | 3-cyclooctyl-1-(3-morpholin-4-ylpropyl)-1-(pyridin-2-ylmethyl)thiourea |
|---|---|
| PubChem CID | 17065733 |
| Molecular Formula | C22H36N4OS |
| Molecular Weight | 404.62 g/mol |
| Exact Mass | 404.26 |
| IUPAC Name | 3-cyclooctyl-1-(3-morpholin-4-ylpropyl)-1-(pyridin-2-ylmethyl)thiourea |
| SMILES | S=C(NC1CCCCCCC1)N(CCCN1CCOCC1)Cc1ccccn1 |
| InChI | InChI=1S/C22H36N4OS/c28-22(24-20-9-4-2-1-3-5-10-20)26(19-21-11-6-7-12-23-21)14-8-13-25-15-17-27-18-16-25/h6-7,11-12,20H,1-5,8-10,13-19H2,(H,24,28) |
| InChIKey | IMGFQKMUKQHRRR-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 40.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.62 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|