C20H27N3S2 — CID 17065699
3-cyclooctyl-1-(pyridin-2-ylmethyl)-1-(thiophen-2-ylmethyl)thiourea (PubChem CID 17065699) has the molecular formula C20H27N3S2 and a molecular weight of 373.59 g/mol. Its IUPAC name is 3-cyclooctyl-1-(pyridin-2-ylmethyl)-1-(thiophen-2-ylmethyl)thiourea.
| Compound Name | 3-cyclooctyl-1-(pyridin-2-ylmethyl)-1-(thiophen-2-ylmethyl)thiourea |
|---|---|
| PubChem CID | 17065699 |
| Molecular Formula | C20H27N3S2 |
| Molecular Weight | 373.59 g/mol |
| Exact Mass | 373.16 |
| IUPAC Name | 3-cyclooctyl-1-(pyridin-2-ylmethyl)-1-(thiophen-2-ylmethyl)thiourea |
| SMILES | S=C(NC1CCCCCCC1)N(Cc1ccccn1)Cc1cccs1 |
| InChI | InChI=1S/C20H27N3S2/c24-20(22-17-9-4-2-1-3-5-10-17)23(16-19-12-8-14-25-19)15-18-11-6-7-13-21-18/h6-8,11-14,17H,1-5,9-10,15-16H2,(H,22,24) |
| InChIKey | ZSPFZFPEMHUXKQ-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.59 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|