C17H26N2S2 — CID 17065604
3-cyclooctyl-1-cyclopropyl-1-(thiophen-2-ylmethyl)thiourea (PubChem CID 17065604) has the molecular formula C17H26N2S2 and a molecular weight of 322.54 g/mol. Its IUPAC name is 3-cyclooctyl-1-cyclopropyl-1-(thiophen-2-ylmethyl)thiourea.
| Compound Name | 3-cyclooctyl-1-cyclopropyl-1-(thiophen-2-ylmethyl)thiourea |
|---|---|
| PubChem CID | 17065604 |
| Molecular Formula | C17H26N2S2 |
| Molecular Weight | 322.54 g/mol |
| Exact Mass | 322.15 |
| IUPAC Name | 3-cyclooctyl-1-cyclopropyl-1-(thiophen-2-ylmethyl)thiourea |
| SMILES | S=C(NC1CCCCCCC1)N(Cc1cccs1)C1CC1 |
| InChI | InChI=1S/C17H26N2S2/c20-17(18-14-7-4-2-1-3-5-8-14)19(15-10-11-15)13-16-9-6-12-21-16/h6,9,12,14-15H,1-5,7-8,10-11,13H2,(H,18,20) |
| InChIKey | IEOBOVAYNVMCEG-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.54 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|