C22H30N2OS2 — CID 29039105
3-cycloheptyl-1-[(1S)-1-(4-methoxyphenyl)ethyl]-1-(thiophen-2-ylmethyl)thiourea (PubChem CID 29039105) has the molecular formula C22H30N2OS2 and a molecular weight of 402.63 g/mol. Its IUPAC name is 3-cycloheptyl-1-[(1S)-1-(4-methoxyphenyl)ethyl]-1-(thiophen-2-ylmethyl)thiourea.
| Compound Name | 3-cycloheptyl-1-[(1S)-1-(4-methoxyphenyl)ethyl]-1-(thiophen-2-ylmethyl)thiourea |
|---|---|
| PubChem CID | 29039105 |
| Molecular Formula | C22H30N2OS2 |
| Molecular Weight | 402.63 g/mol |
| Exact Mass | 402.18 |
| IUPAC Name | 3-cycloheptyl-1-[(1S)-1-(4-methoxyphenyl)ethyl]-1-(thiophen-2-ylmethyl)thiourea |
| SMILES | COc1ccc([C@H](C)N(Cc2cccs2)C(=S)NC2CCCCCC2)cc1 |
| InChI | InChI=1S/C22H30N2OS2/c1-17(18-11-13-20(25-2)14-12-18)24(16-21-10-7-15-27-21)22(26)23-19-8-5-3-4-6-9-19/h7,10-15,17,19H,3-6,8-9,16H2,1-2H3,(H,23,26)/t17-/m0/s1 |
| InChIKey | AKALWIKPTQVDGK-KRWDZBQOSA-N |
| XLogP | 5.92 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.63 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|