C24H33N3OS — CID 17065660
3-cyclooctyl-1-[1-(4-methoxyphenyl)ethyl]-1-(pyridin-2-ylmethyl)thiourea (PubChem CID 17065660) has the molecular formula C24H33N3OS and a molecular weight of 411.62 g/mol. Its IUPAC name is 3-cyclooctyl-1-[1-(4-methoxyphenyl)ethyl]-1-(pyridin-2-ylmethyl)thiourea.
| Compound Name | 3-cyclooctyl-1-[1-(4-methoxyphenyl)ethyl]-1-(pyridin-2-ylmethyl)thiourea |
|---|---|
| PubChem CID | 17065660 |
| Molecular Formula | C24H33N3OS |
| Molecular Weight | 411.62 g/mol |
| Exact Mass | 411.23 |
| IUPAC Name | 3-cyclooctyl-1-[1-(4-methoxyphenyl)ethyl]-1-(pyridin-2-ylmethyl)thiourea |
| SMILES | COc1ccc(C(C)N(Cc2ccccn2)C(=S)NC2CCCCCCC2)cc1 |
| InChI | InChI=1S/C24H33N3OS/c1-19(20-13-15-23(28-2)16-14-20)27(18-22-12-8-9-17-25-22)24(29)26-21-10-6-4-3-5-7-11-21/h8-9,12-17,19,21H,3-7,10-11,18H2,1-2H3,(H,26,29) |
| InChIKey | WVRITDTXXMXHHT-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 37.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.62 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|