C10H14N2S2 — CID 115570921
3-cyclopropyl-1-methyl-1-(thiophen-2-ylmethyl)thiourea (PubChem CID 115570921) has the molecular formula C10H14N2S2 and a molecular weight of 226.37 g/mol. Its IUPAC name is 3-cyclopropyl-1-methyl-1-(thiophen-2-ylmethyl)thiourea.
| Compound Name | 3-cyclopropyl-1-methyl-1-(thiophen-2-ylmethyl)thiourea |
|---|---|
| PubChem CID | 115570921 |
| Molecular Formula | C10H14N2S2 |
| Molecular Weight | 226.37 g/mol |
| Exact Mass | 226.06 |
| IUPAC Name | 3-cyclopropyl-1-methyl-1-(thiophen-2-ylmethyl)thiourea |
| SMILES | CN(Cc1cccs1)C(=S)NC1CC1 |
| InChI | InChI=1S/C10H14N2S2/c1-12(7-9-3-2-6-14-9)10(13)11-8-4-5-8/h2-3,6,8H,4-5,7H2,1H3,(H,11,13) |
| InChIKey | MOEGFAPOWYOMGG-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.37 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|