C14H22N2S2 — CID 116509360
3-cyclopentyl-1-methyl-1-(1-thiophen-2-ylpropan-2-yl)thiourea (PubChem CID 116509360) has the molecular formula C14H22N2S2 and a molecular weight of 282.48 g/mol. Its IUPAC name is 3-cyclopentyl-1-methyl-1-(1-thiophen-2-ylpropan-2-yl)thiourea.
| Compound Name | 3-cyclopentyl-1-methyl-1-(1-thiophen-2-ylpropan-2-yl)thiourea |
|---|---|
| PubChem CID | 116509360 |
| Molecular Formula | C14H22N2S2 |
| Molecular Weight | 282.48 g/mol |
| Exact Mass | 282.12 |
| IUPAC Name | 3-cyclopentyl-1-methyl-1-(1-thiophen-2-ylpropan-2-yl)thiourea |
| SMILES | CC(Cc1cccs1)N(C)C(=S)NC1CCCC1 |
| InChI | InChI=1S/C14H22N2S2/c1-11(10-13-8-5-9-18-13)16(2)14(17)15-12-6-3-4-7-12/h5,8-9,11-12H,3-4,6-7,10H2,1-2H3,(H,15,17) |
| InChIKey | PXKDBPPTKGCWCQ-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.48 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|